C10H4F3NO3 — CID 22690298
6,7,8-trifluoro-2-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 22690298) has the molecular formula C10H4F3NO3 and a molecular weight of 243.14 g/mol. Its IUPAC name is 6,7,8-trifluoro-2-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6,7,8-trifluoro-2-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22690298 |
| Molecular Formula | C10H4F3NO3 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 6,7,8-trifluoro-2-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(F)c(F)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C10H4F3NO3/c11-5-2-3-1-4(10(16)17)9(15)14-8(3)7(13)6(5)12/h1-2H,(H,14,15)(H,16,17) |
| InChIKey | PENCTVYIKBYSEH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|