About 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide
2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide (PubChem CID 2269031) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide.
Molecular Properties
| Compound Name | 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide |
| PubChem CID | 2269031 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide |
| SMILES | CC1=C(c2ccccc2)[N+](=O)C2(CCCC2)N1[O-] |
| InChI | InChI=1S/C14H16N2O2/c1-11-13(12-7-3-2-4-8-12)16(18)14(15(11)17)9-5-6-10-14/h2-4,7-8H,5-6,9-10H2,1H3 |
| InChIKey | MAHQFZCTVDFVNK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide?
The IUPAC name of 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide (CID 2269031) is 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide.
What is the SMILES notation for 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide?
The canonical SMILES for 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide is CC1=C(c2ccccc2)[N+](=O)C2(CCCC2)N1[O-].
What is the InChIKey of 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide?
The InChIKey is MAHQFZCTVDFVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-11-13(12-7-3-2-4-8-12)16(18)14(15(11)17)9-5-6-10-14/h2-4,7-8H,5-6,9-10H2,1H3.
What are the key properties of 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide?
2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide has a molecular weight of 244.29 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-oxido-3-phenyl-1-aza-4-azoniaspiro[4.4]non-2-ene 4-oxide is sourced from PubChem (CID 2269031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).