C19H24N2O3 — CID 22691311
(2S)-2-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide (PubChem CID 22691311) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 22691311 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (2S)-2-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-phenylpropanamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)[C@@H](N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-23-16-8-9-18(24-2)15(13-16)10-11-21-19(22)17(20)12-14-6-4-3-5-7-14/h3-9,13,17H,10-12,20H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | HUDPOXWIGKGTQT-KRWDZBQOSA-N |
| XLogP | 1.93 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |