About 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide
4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide (PubChem CID 22692751) has the molecular formula C17H15ClN4O3
and a molecular weight of 358.79 g/mol. Its IUPAC name is 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide.
Molecular Properties
| Compound Name | 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide |
| PubChem CID | 22692751 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide |
| SMILES | COc1cc2nc(Cl)nc(Nc3ccc(C(N)=O)cc3)c2cc1OC |
| InChI | InChI=1S/C17H15ClN4O3/c1-24-13-7-11-12(8-14(13)25-2)21-17(18)22-16(11)20-10-5-3-9(4-6-10)15(19)23/h3-8H,1-2H3,(H2,19,23)(H,20,21,22) |
| InChIKey | RLPIYJHRUPAEHW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide?
The IUPAC name of 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide (CID 22692751) is 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide.
What is the SMILES notation for 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide?
The canonical SMILES for 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide is COc1cc2nc(Cl)nc(Nc3ccc(C(N)=O)cc3)c2cc1OC.
What is the InChIKey of 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide?
The InChIKey is RLPIYJHRUPAEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O3/c1-24-13-7-11-12(8-14(13)25-2)21-17(18)22-16(11)20-10-5-3-9(4-6-10)15(19)23/h3-8H,1-2H3,(H2,19,23)(H,20,21,22).
What are the key properties of 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide?
4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide has a molecular weight of 358.79 g/mol, XLogP of 3.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzamide is sourced from PubChem (CID 22692751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).