C16H23ClN4O2 — CID 22692934
N-(2-chloro-6,7-dimethoxyquinazolin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 22692934) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(2-chloro-6,7-dimethoxyquinazolin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(2-chloro-6,7-dimethoxyquinazolin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 22692934 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(2-chloro-6,7-dimethoxyquinazolin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | COc1cc2nc(Cl)nc(NCCCCN(C)C)c2cc1OC |
| InChI | InChI=1S/C16H23ClN4O2/c1-21(2)8-6-5-7-18-15-11-9-13(22-3)14(23-4)10-12(11)19-16(17)20-15/h9-10H,5-8H2,1-4H3,(H,18,19,20) |
| InChIKey | LJWXBJNJNHUTSO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|