About 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline
2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline (PubChem CID 22693293) has the molecular formula C17H22ClN3O2
and a molecular weight of 335.84 g/mol. Its IUPAC name is 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline.
Molecular Properties
| Compound Name | 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline |
| PubChem CID | 22693293 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline |
| SMILES | CCC1CCCCN1c1nc(Cl)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C17H22ClN3O2/c1-4-11-7-5-6-8-21(11)16-12-9-14(22-2)15(23-3)10-13(12)19-17(18)20-16/h9-11H,4-8H2,1-3H3 |
| InChIKey | YUJBSLFSQWAJKP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline?
The IUPAC name of 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline (CID 22693293) is 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline.
What is the SMILES notation for 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline?
The canonical SMILES for 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline is CCC1CCCCN1c1nc(Cl)nc2cc(OC)c(OC)cc12.
What is the InChIKey of 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline?
The InChIKey is YUJBSLFSQWAJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O2/c1-4-11-7-5-6-8-21(11)16-12-9-14(22-2)15(23-3)10-13(12)19-17(18)20-16/h9-11H,4-8H2,1-3H3.
What are the key properties of 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline?
2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline has a molecular weight of 335.84 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2-ethylpiperidin-1-yl)-6,7-dimethoxyquinazoline is sourced from PubChem (CID 22693293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).