About 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline
4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline (PubChem CID 22693550) has the molecular formula C11H8ClF3N2O2
and a molecular weight of 292.64 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline.
Molecular Properties
| Compound Name | 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline |
| PubChem CID | 22693550 |
| Molecular Formula | C11H8ClF3N2O2 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline |
| SMILES | COc1cc2nc(C(F)(F)F)nc(Cl)c2cc1OC |
| InChI | InChI=1S/C11H8ClF3N2O2/c1-18-7-3-5-6(4-8(7)19-2)16-10(11(13,14)15)17-9(5)12/h3-4H,1-2H3 |
| InChIKey | YMCGAIKBFPLEEO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline?
The IUPAC name of 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline (CID 22693550) is 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline.
What is the SMILES notation for 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline?
The canonical SMILES for 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline is COc1cc2nc(C(F)(F)F)nc(Cl)c2cc1OC.
What is the InChIKey of 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline?
The InChIKey is YMCGAIKBFPLEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF3N2O2/c1-18-7-3-5-6(4-8(7)19-2)16-10(11(13,14)15)17-9(5)12/h3-4H,1-2H3.
What are the key properties of 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline?
4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline has a molecular weight of 292.64 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dimethoxy-2-(trifluoromethyl)quinazoline is sourced from PubChem (CID 22693550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).