About 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one
4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one (PubChem CID 22694167) has the molecular formula C13H15NO3S2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one.
Molecular Properties
| Compound Name | 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one |
| PubChem CID | 22694167 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one |
| SMILES | O=C1CSC2(CCS(=O)(=O)C2)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO3S2/c15-12-9-18-13(6-7-19(16,17)10-13)14(12)8-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | NFLZBELSPJFBGV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one?
The IUPAC name of 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one (CID 22694167) is 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one.
What is the SMILES notation for 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one?
The canonical SMILES for 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one is O=C1CSC2(CCS(=O)(=O)C2)N1Cc1ccccc1.
What is the InChIKey of 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one?
The InChIKey is NFLZBELSPJFBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3S2/c15-12-9-18-13(6-7-19(16,17)10-13)14(12)8-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one?
4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one has a molecular weight of 297.40 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-7,7-dioxo-1,7λ6-dithia-4-azaspiro[4.4]nonan-3-one is sourced from PubChem (CID 22694167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).