C14H18N2O5S2 — CID 22694442
1,1-dioxo-2-(4-piperidin-1-ylsulfonylphenyl)-1,2-thiazolidin-3-one (PubChem CID 22694442) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1,1-dioxo-2-(4-piperidin-1-ylsulfonylphenyl)-1,2-thiazolidin-3-one.
| Compound Name | 1,1-dioxo-2-(4-piperidin-1-ylsulfonylphenyl)-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 22694442 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1,1-dioxo-2-(4-piperidin-1-ylsulfonylphenyl)-1,2-thiazolidin-3-one |
| SMILES | O=C1CCS(=O)(=O)N1c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C14H18N2O5S2/c17-14-8-11-22(18,19)16(14)12-4-6-13(7-5-12)23(20,21)15-9-2-1-3-10-15/h4-7H,1-3,8-11H2 |
| InChIKey | XXGNHLIAPJIYFB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |