About 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide
3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide (PubChem CID 22695498) has the molecular formula C17H25NO5S2
and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide |
| PubChem CID | 22695498 |
| Molecular Formula | C17H25NO5S2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)C1CS(=O)(=O)CC1N1CCCCC1 |
| InChI | InChI=1S/C17H25NO5S2/c1-13-6-7-15(23-2)16(10-13)25(21,22)17-12-24(19,20)11-14(17)18-8-4-3-5-9-18/h6-7,10,14,17H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | FZBHKVSQPFWGAK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide?
The IUPAC name of 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide (CID 22695498) is 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide.
What is the SMILES notation for 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide?
The canonical SMILES for 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide is COc1ccc(C)cc1S(=O)(=O)C1CS(=O)(=O)CC1N1CCCCC1.
What is the InChIKey of 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide?
The InChIKey is FZBHKVSQPFWGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO5S2/c1-13-6-7-15(23-2)16(10-13)25(21,22)17-12-24(19,20)11-14(17)18-8-4-3-5-9-18/h6-7,10,14,17H,3-5,8-9,11-12H2,1-2H3.
What are the key properties of 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide?
3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide has a molecular weight of 387.52 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxy-5-methylphenyl)sulfonyl-4-piperidin-1-ylthiolane 1,1-dioxide is sourced from PubChem (CID 22695498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).