C30H27BrN2O8 — CID 22695839
7-bromo-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)chromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 22695839) has the molecular formula C30H27BrN2O8 and a molecular weight of 623.46 g/mol. Its IUPAC name is 7-bromo-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)chromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 7-bromo-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)chromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 22695839 |
| Molecular Formula | C30H27BrN2O8 |
| Molecular Weight | 623.46 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | 7-bromo-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)chromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COc1ccc(CCn2c(-c3cc(OC)c(OC)c(OC)c3)nc3oc4ccc(Br)cc4c(=O)c3c2=O)cc1OC |
| InChI | InChI=1S/C30H27BrN2O8/c1-36-21-8-6-16(12-22(21)37-2)10-11-33-28(17-13-23(38-3)27(40-5)24(14-17)39-4)32-29-25(30(33)35)26(34)19-15-18(31)7-9-20(19)41-29/h6-9,12-15H,10-11H2,1-5H3 |
| InChIKey | CJZVLLGDGRUDAW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 111.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|