C24H27ClN2O5S — CID 22695933
N-[3-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-3-methoxybenzamide (PubChem CID 22695933) has the molecular formula C24H27ClN2O5S and a molecular weight of 491.01 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-3-methoxybenzamide.
| Compound Name | N-[3-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 22695933 |
| Molecular Formula | C24H27ClN2O5S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-[3-(3-chlorophenyl)sulfonyl-1-(3-methoxypropyl)-4,5-dimethylpyrrol-2-yl]-3-methoxybenzamide |
| SMILES | COCCCn1c(C)c(C)c(S(=O)(=O)c2cccc(Cl)c2)c1NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C24H27ClN2O5S/c1-16-17(2)27(12-7-13-31-3)23(26-24(28)18-8-5-10-20(14-18)32-4)22(16)33(29,30)21-11-6-9-19(25)15-21/h5-6,8-11,14-15H,7,12-13H2,1-4H3,(H,26,28) |
| InChIKey | OSBMKLCAMHLUQR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|