C23H32N4O10 — CID 22698104
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 22698104) has the molecular formula C23H32N4O10 and a molecular weight of 524.53 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22698104 |
| Molecular Formula | C23H32N4O10 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H32N4O10/c1-12(28)19(22(35)25-15(23(36)37)8-10-18(31)32)27-21(34)16(11-13-5-3-2-4-6-13)26-20(33)14(24)7-9-17(29)30/h2-6,12,14-16,19,28H,7-11,24H2,1H3,(H,25,35)(H,26,33)(H,27,34)(H,29,30)(H,31,32)(H,36,37) |
| InChIKey | PSHWAAOUGHOWER-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 245.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |