C26H35N5O9S — CID 22699619
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid (PubChem CID 22699619) has the molecular formula C26H35N5O9S and a molecular weight of 593.66 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22699619 |
| Molecular Formula | C26H35N5O9S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
| SMILES | CSCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H35N5O9S/c1-41-11-10-18(24(37)30-19(26(39)40)7-9-22(34)35)29-25(38)20(31-23(36)16(27)6-8-21(32)33)12-14-13-28-17-5-3-2-4-15(14)17/h2-5,13,16,18-20,28H,6-12,27H2,1H3,(H,29,38)(H,30,37)(H,31,36)(H,32,33)(H,34,35)(H,39,40) |
| InChIKey | ZRLDRMVTFRMBHI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |