C26H36N6O8 — CID 22699760
4-amino-5-[[1-[[1-[(4-amino-1-carboxy-4-oxobutyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 22699760) has the molecular formula C26H36N6O8 and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[(4-amino-1-carboxy-4-oxobutyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[(4-amino-1-carboxy-4-oxobutyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22699760 |
| Molecular Formula | C26H36N6O8 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 4-amino-5-[[1-[[1-[(4-amino-1-carboxy-4-oxobutyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C26H36N6O8/c1-13(2)22(25(38)30-18(26(39)40)8-9-20(28)33)32-24(37)19(31-23(36)16(27)7-10-21(34)35)11-14-12-29-17-6-4-3-5-15(14)17/h3-6,12-13,16,18-19,22,29H,7-11,27H2,1-2H3,(H2,28,33)(H,30,38)(H,31,36)(H,32,37)(H,34,35)(H,39,40) |
| InChIKey | PSKSKFZJFNGWIH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |