C22H32N4O8 — CID 22701664
2-[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]butanedioic acid (PubChem CID 22701664) has the molecular formula C22H32N4O8 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]butanedioic acid.
| Compound Name | 2-[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 22701664 |
| Molecular Formula | C22H32N4O8 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]butanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H32N4O8/c1-4-11(2)18(23)21(32)25-15(9-13-5-7-14(27)8-6-13)20(31)24-12(3)19(30)26-16(22(33)34)10-17(28)29/h5-8,11-12,15-16,18,27H,4,9-10,23H2,1-3H3,(H,24,31)(H,25,32)(H,26,30)(H,28,29)(H,33,34) |
| InChIKey | XEVNFWIBGZRJCQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |