C19H37N7O5 — CID 22702086
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 22702086) has the molecular formula C19H37N7O5 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22702086 |
| Molecular Formula | C19H37N7O5 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O)C(C)C |
| InChI | InChI=1S/C19H37N7O5/c1-5-11(4)14(20)17(30)26-15(10(2)3)18(31)25-12(7-6-8-23-19(21)22)16(29)24-9-13(27)28/h10-12,14-15H,5-9,20H2,1-4H3,(H,24,29)(H,25,31)(H,26,30)(H,27,28)(H4,21,22,23) |
| InChIKey | WFJLIUCLMSIPHE-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|