C20H39N7O5S — CID 22702858
2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 22702858) has the molecular formula C20H39N7O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22702858 |
| Molecular Formula | C20H39N7O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(C)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C20H39N7O5S/c1-11(2)10-13(21)17(29)26-14(6-5-8-24-20(22)23)18(30)25-12(3)16(28)27-15(19(31)32)7-9-33-4/h11-15H,5-10,21H2,1-4H3,(H,25,30)(H,26,29)(H,27,28)(H,31,32)(H4,22,23,24) |
| InChIKey | SCCVANYRRXZQDC-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|