C23H32N6O6 — CID 22703400
2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22703400) has the molecular formula C23H32N6O6 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22703400 |
| Molecular Formula | C23H32N6O6 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CC(N)=O)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H32N6O6/c1-12(2)7-15(24)21(32)29-17(9-19(25)30)22(33)27-11-20(31)28-18(23(34)35)8-13-10-26-16-6-4-3-5-14(13)16/h3-6,10,12,15,17-18,26H,7-9,11,24H2,1-2H3,(H2,25,30)(H,27,33)(H,28,31)(H,29,32)(H,34,35) |
| InChIKey | OXNGQKMPQLRRAZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |