C15H16N4O3S — CID 2270493
[4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2270493) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is [4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2270493 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C=NN=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C15H16N4O3S/c1-11-2-8-14(9-3-11)23(20,21)22-13-6-4-12(5-7-13)10-18-19-15(16)17/h2-10H,1H3,(H4,16,17,19) |
| InChIKey | TUMWZFCXULDBAL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|