C31H46N2 — CID 22706934
N,N'-bis[2,4,6-tri(propan-2-yl)phenyl]methanediimine (PubChem CID 22706934) has the molecular formula C31H46N2 and a molecular weight of 446.72 g/mol. Its IUPAC name is N,N'-bis[2,4,6-tri(propan-2-yl)phenyl]methanediimine.
| Compound Name | N,N'-bis[2,4,6-tri(propan-2-yl)phenyl]methanediimine |
|---|---|
| PubChem CID | 22706934 |
| Molecular Formula | C31H46N2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.37 |
| IUPAC Name | N,N'-bis[2,4,6-tri(propan-2-yl)phenyl]methanediimine |
| SMILES | CC(C)c1cc(C(C)C)c(N=C=Nc2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C31H46N2/c1-18(2)24-13-26(20(5)6)30(27(14-24)21(7)8)32-17-33-31-28(22(9)10)15-25(19(3)4)16-29(31)23(11)12/h13-16,18-23H,1-12H3 |
| InChIKey | WRWZSGSJXXFJOZ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|