About 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione
5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 22707040) has the molecular formula C10H9IN2O4
and a molecular weight of 348.10 g/mol. Its IUPAC name is 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| PubChem CID | 22707040 |
| Molecular Formula | C10H9IN2O4 |
| Molecular Weight | 348.10 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | COc1cc2[nH]c(=O)[nH]c(=O)c2c(I)c1OC |
| InChI | InChI=1S/C10H9IN2O4/c1-16-5-3-4-6(7(11)8(5)17-2)9(14)13-10(15)12-4/h3H,1-2H3,(H2,12,13,14,15) |
| InChIKey | DUOAMFNJOVGYLY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione?
The IUPAC name of 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione (CID 22707040) is 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione.
What is the SMILES notation for 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione?
The canonical SMILES for 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione is COc1cc2[nH]c(=O)[nH]c(=O)c2c(I)c1OC.
What is the InChIKey of 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione?
The InChIKey is DUOAMFNJOVGYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2O4/c1-16-5-3-4-6(7(11)8(5)17-2)9(14)13-10(15)12-4/h3H,1-2H3,(H2,12,13,14,15).
What are the key properties of 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione?
5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione has a molecular weight of 348.10 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-6,7-dimethoxy-1H-quinazoline-2,4-dione is sourced from PubChem (CID 22707040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).