About 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine
1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine (PubChem CID 22707889) has the molecular formula C22H33N3
and a molecular weight of 339.53 g/mol. Its IUPAC name is 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine.
Molecular Properties
| Compound Name | 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine |
| PubChem CID | 22707889 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine |
| SMILES | CCCCCCN1CCC(C)(c2cccc(-c3cn[nH]c3)c2)C(C)C1 |
| InChI | InChI=1S/C22H33N3/c1-4-5-6-7-12-25-13-11-22(3,18(2)17-25)21-10-8-9-19(14-21)20-15-23-24-16-20/h8-10,14-16,18H,4-7,11-13,17H2,1-3H3,(H,23,24) |
| InChIKey | KLYMRLPYQVHNQG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine?
The IUPAC name of 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine (CID 22707889) is 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine.
What is the SMILES notation for 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine?
The canonical SMILES for 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine is CCCCCCN1CCC(C)(c2cccc(-c3cn[nH]c3)c2)C(C)C1.
What is the InChIKey of 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine?
The InChIKey is KLYMRLPYQVHNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3/c1-4-5-6-7-12-25-13-11-22(3,18(2)17-25)21-10-8-9-19(14-21)20-15-23-24-16-20/h8-10,14-16,18H,4-7,11-13,17H2,1-3H3,(H,23,24).
What are the key properties of 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine?
1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine has a molecular weight of 339.53 g/mol, XLogP of 5.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-3,4-dimethyl-4-[3-(1H-pyrazol-4-yl)phenyl]piperidine is sourced from PubChem (CID 22707889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).