About 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile
2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile (PubChem CID 22707974) has the molecular formula C18H9F6N3O
and a molecular weight of 397.28 g/mol. Its IUPAC name is 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile |
| PubChem CID | 22707974 |
| Molecular Formula | C18H9F6N3O |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2ccco2)nc1N |
| InChI | InChI=1S/C18H9F6N3O/c19-17(20,21)11-4-9(5-12(7-11)18(22,23)24)13-6-10(8-25)16(26)27-15(13)14-2-1-3-28-14/h1-7H,(H2,26,27) |
| InChIKey | FCWJKSJBSHXNIC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile?
The IUPAC name of 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile (CID 22707974) is 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile?
The canonical SMILES for 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile is N#Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2ccco2)nc1N.
What is the InChIKey of 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile?
The InChIKey is FCWJKSJBSHXNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F6N3O/c19-17(20,21)11-4-9(5-12(7-11)18(22,23)24)13-6-10(8-25)16(26)27-15(13)14-2-1-3-28-14/h1-7H,(H2,26,27).
What are the key properties of 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile?
2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile has a molecular weight of 397.28 g/mol, XLogP of 5.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[3,5-bis(trifluoromethyl)phenyl]-6-(furan-2-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 22707974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).