C22H12Br4N2O2 — CID 22708321
2,5-dibromo-5,6-bis(5-bromo-1H-indol-3-yl)cyclohex-2-ene-1,4-dione (PubChem CID 22708321) has the molecular formula C22H12Br4N2O2 and a molecular weight of 655.97 g/mol. Its IUPAC name is 2,5-dibromo-5,6-bis(5-bromo-1H-indol-3-yl)cyclohex-2-ene-1,4-dione.
| Compound Name | 2,5-dibromo-5,6-bis(5-bromo-1H-indol-3-yl)cyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 22708321 |
| Molecular Formula | C22H12Br4N2O2 |
| Molecular Weight | 655.97 g/mol |
| Exact Mass | 651.76 |
| IUPAC Name | 2,5-dibromo-5,6-bis(5-bromo-1H-indol-3-yl)cyclohex-2-ene-1,4-dione |
| SMILES | O=C1C(Br)=CC(=O)C(Br)(c2c[nH]c3ccc(Br)cc23)C1c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C22H12Br4N2O2/c23-10-1-3-17-12(5-10)14(8-27-17)20-21(30)16(25)7-19(29)22(20,26)15-9-28-18-4-2-11(24)6-13(15)18/h1-9,20,27-28H |
| InChIKey | IKSAVUYLHPSJQV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.97 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|