About 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one
8-(trifluoromethoxy)-2,3-dihydrochromen-4-one (PubChem CID 22708350) has the molecular formula C10H7F3O3
and a molecular weight of 232.16 g/mol. Its IUPAC name is 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one |
| PubChem CID | 22708350 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2c(OC(F)(F)F)cccc21 |
| InChI | InChI=1S/C10H7F3O3/c11-10(12,13)16-8-3-1-2-6-7(14)4-5-15-9(6)8/h1-3H,4-5H2 |
| InChIKey | NVTWXGBPZHFELL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one?
The IUPAC name of 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one (CID 22708350) is 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one is O=C1CCOc2c(OC(F)(F)F)cccc21.
What is the InChIKey of 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one?
The InChIKey is NVTWXGBPZHFELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3O3/c11-10(12,13)16-8-3-1-2-6-7(14)4-5-15-9(6)8/h1-3H,4-5H2.
What are the key properties of 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one?
8-(trifluoromethoxy)-2,3-dihydrochromen-4-one has a molecular weight of 232.16 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethoxy)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 22708350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).