About 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol
4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol (PubChem CID 22708583) has the molecular formula C12H6F4O2
and a molecular weight of 258.17 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol |
| PubChem CID | 22708583 |
| Molecular Formula | C12H6F4O2 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol |
| SMILES | Oc1cc(F)c(-c2c(F)cc(O)cc2F)c(F)c1 |
| InChI | InChI=1S/C12H6F4O2/c13-7-1-5(17)2-8(14)11(7)12-9(15)3-6(18)4-10(12)16/h1-4,17-18H |
| InChIKey | RMFKONDLPMDUJM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol?
The IUPAC name of 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol (CID 22708583) is 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol.
What is the SMILES notation for 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol?
The canonical SMILES for 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol is Oc1cc(F)c(-c2c(F)cc(O)cc2F)c(F)c1.
What is the InChIKey of 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol?
The InChIKey is RMFKONDLPMDUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F4O2/c13-7-1-5(17)2-8(14)11(7)12-9(15)3-6(18)4-10(12)16/h1-4,17-18H.
What are the key properties of 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol?
4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol has a molecular weight of 258.17 g/mol, XLogP of 3.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-difluoro-4-hydroxyphenyl)-3,5-difluorophenol is sourced from PubChem (CID 22708583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).