About 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid
3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid (PubChem CID 22708867) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid.
Analyze 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid?
The IUPAC name of 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid (CID 22708867) is 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid.
What is the SMILES notation for 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid?
The canonical SMILES for 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid is CCNC1(C(=O)O)C2CC3C1C3(C(=O)O)C2.
What is the InChIKey of 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid?
The InChIKey is MUYZSHDFEONMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-2-12-11(9(15)16)5-3-6-7(11)10(6,4-5)8(13)14/h5-7,12H,2-4H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid?
3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid has a molecular weight of 225.24 g/mol, XLogP of 0.16, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)tricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid is sourced from PubChem (CID 22708867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).