C19H42P2 — CID 22708886
2,4,4-trimethylpentyl-[3-(2,4,4-trimethylpentylphosphanyl)propyl]phosphane (PubChem CID 22708886) has the molecular formula C19H42P2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2,4,4-trimethylpentyl-[3-(2,4,4-trimethylpentylphosphanyl)propyl]phosphane.
| Compound Name | 2,4,4-trimethylpentyl-[3-(2,4,4-trimethylpentylphosphanyl)propyl]phosphane |
|---|---|
| PubChem CID | 22708886 |
| Molecular Formula | C19H42P2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 2,4,4-trimethylpentyl-[3-(2,4,4-trimethylpentylphosphanyl)propyl]phosphane |
| SMILES | CC(CPCCCPCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C19H42P2/c1-16(12-18(3,4)5)14-20-10-9-11-21-15-17(2)13-19(6,7)8/h16-17,20-21H,9-15H2,1-8H3 |
| InChIKey | LKEGIEHKSWSDCU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|