C10H7F5O2 — CID 22709024
1-(2-ethenoxyethoxy)-2,3,4,5,6-pentafluorobenzene (PubChem CID 22709024) has the molecular formula C10H7F5O2 and a molecular weight of 254.15 g/mol. Its IUPAC name is 1-(2-ethenoxyethoxy)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2-ethenoxyethoxy)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 22709024 |
| Molecular Formula | C10H7F5O2 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-(2-ethenoxyethoxy)-2,3,4,5,6-pentafluorobenzene |
| SMILES | C=COCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F5O2/c1-2-16-3-4-17-10-8(14)6(12)5(11)7(13)9(10)15/h2H,1,3-4H2 |
| InChIKey | FMWVTOSPDORJOT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|