C25H28N6O3S3 — CID 22709808
3-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]propanenitrile (PubChem CID 22709808) has the molecular formula C25H28N6O3S3 and a molecular weight of 556.74 g/mol. Its IUPAC name is 3-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]propanenitrile.
| Compound Name | 3-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]propanenitrile |
|---|---|
| PubChem CID | 22709808 |
| Molecular Formula | C25H28N6O3S3 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 3-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]propanenitrile |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)N4CCC5=C(N4)SC(C)N5C)C(CCC#N)C3)sc2c1 |
| InChI | InChI=1S/C25H28N6O3S3/c1-4-18-7-8-19-15-23(36-22(19)14-18)37(33,34)29-12-13-30(20(16-29)6-5-10-26)25(32)31-11-9-21-24(27-31)35-17(2)28(21)3/h1,7-8,14-15,17,20,27H,5-6,9,11-13,16H2,2-3H3 |
| InChIKey | GHWJYNYDHCHOIW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|