C26H32N6O4S3 — CID 22709931
2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-N,N-dimethylacetamide (PubChem CID 22709931) has the molecular formula C26H32N6O4S3 and a molecular weight of 588.78 g/mol. Its IUPAC name is 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 22709931 |
| Molecular Formula | C26H32N6O4S3 |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-N,N-dimethylacetamide |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)N4CCC5=C(N4)SC(C)N5C)C(CC(=O)N(C)C)C3)sc2c1 |
| InChI | InChI=1S/C26H32N6O4S3/c1-6-18-7-8-19-14-24(38-22(19)13-18)39(35,36)30-11-12-31(20(16-30)15-23(33)28(3)4)26(34)32-10-9-21-25(27-32)37-17(2)29(21)5/h1,7-8,13-14,17,20,27H,9-12,15-16H2,2-5H3 |
| InChIKey | BIOREIQHPJCZDW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|