C22H25N5O3S3 — CID 22710106
(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone (PubChem CID 22710106) has the molecular formula C22H25N5O3S3 and a molecular weight of 503.68 g/mol. Its IUPAC name is (5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone.
| Compound Name | (5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22710106 |
| Molecular Formula | C22H25N5O3S3 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)N4CCC5=C(N4)SC(C)N5C)CC3)sc2c1 |
| InChI | InChI=1S/C22H25N5O3S3/c1-4-16-5-6-17-14-20(32-19(17)13-16)33(29,30)26-11-9-25(10-12-26)22(28)27-8-7-18-21(23-27)31-15(2)24(18)3/h1,5-6,13-15,23H,7-12H2,2-3H3 |
| InChIKey | BCGWWTJGNOOHNY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|