About ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate
ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate (PubChem CID 22710442) has the molecular formula C21H34N2O4S
and a molecular weight of 410.58 g/mol. Its IUPAC name is ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate |
| PubChem CID | 22710442 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(CCCc2cccs2)C1 |
| InChI | InChI=1S/C21H34N2O4S/c1-20(2,3)26-18(24)22-12-13-23(19(25)27-21(4,5)6)16(15-22)9-7-10-17-11-8-14-28-17/h8,11,14,16H,7,9-10,12-13,15H2,1-6H3 |
| InChIKey | IWDHXIBZYSPRHQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate?
The IUPAC name of ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate (CID 22710442) is ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate.
What is the SMILES notation for ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate?
The canonical SMILES for ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(CCCc2cccs2)C1.
What is the InChIKey of ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate?
The InChIKey is IWDHXIBZYSPRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O4S/c1-20(2,3)26-18(24)22-12-13-23(19(25)27-21(4,5)6)16(15-22)9-7-10-17-11-8-14-28-17/h8,11,14,16H,7,9-10,12-13,15H2,1-6H3.
What are the key properties of ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate?
ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate has a molecular weight of 410.58 g/mol, XLogP of 4.93, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-(3-thiophen-2-ylpropyl)piperazine-1,4-dicarboxylate is sourced from PubChem (CID 22710442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).