C28H34N6O5S3 — CID 22710943
2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-1-morpholin-4-ylethanone (PubChem CID 22710943) has the molecular formula C28H34N6O5S3 and a molecular weight of 630.82 g/mol. Its IUPAC name is 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 22710943 |
| Molecular Formula | C28H34N6O5S3 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | 2-[1-(5,6-dimethyl-1,3,4,6-tetrahydro-[1,3]thiazolo[5,4-c]pyridazine-2-carbonyl)-4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-2-yl]-1-morpholin-4-ylethanone |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)N4CCC5=C(N4)SC(C)N5C)C(CC(=O)N4CCOCC4)C3)sc2c1 |
| InChI | InChI=1S/C28H34N6O5S3/c1-4-20-5-6-21-16-26(41-24(21)15-20)42(37,38)32-9-10-33(22(18-32)17-25(35)31-11-13-39-14-12-31)28(36)34-8-7-23-27(29-34)40-19(2)30(23)3/h1,5-6,15-16,19,22,29H,7-14,17-18H2,2-3H3 |
| InChIKey | MOUAPCMIRCLKCP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|