About N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide
N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide (PubChem CID 2271108) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide |
| PubChem CID | 2271108 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C11H19N3O3/c1-2-3-12-10(15)11(16)13-4-5-14-6-8-17-9-7-14/h2H,1,3-9H2,(H,12,15)(H,13,16) |
| InChIKey | FTKALDAAGGJZGL-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide?
The IUPAC name of N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide (CID 2271108) is N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide.
What is the SMILES notation for N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide?
The canonical SMILES for N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide is C=CCNC(=O)C(=O)NCCN1CCOCC1.
What is the InChIKey of N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide?
The InChIKey is FTKALDAAGGJZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-2-3-12-10(15)11(16)13-4-5-14-6-8-17-9-7-14/h2H,1,3-9H2,(H,12,15)(H,13,16).
What are the key properties of N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide?
N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide has a molecular weight of 241.29 g/mol, XLogP of -1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-morpholin-4-ylethyl)-N'-prop-2-enyloxamide is sourced from PubChem (CID 2271108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).