C26H29ClN3O3S+ — CID 22711111
[4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-(2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-yl)methanone (PubChem CID 22711111) has the molecular formula C26H29ClN3O3S+ and a molecular weight of 499.06 g/mol. Its IUPAC name is [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-(2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-yl)methanone.
| Compound Name | [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-(2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-yl)methanone |
|---|---|
| PubChem CID | 22711111 |
| Molecular Formula | C26H29ClN3O3S+ |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [4-(6-chloronaphthalen-2-yl)sulfonylpiperazin-1-yl]-(2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6-yl)methanone |
| SMILES | C[N+]1(C)CCc2cc(C(=O)N3CCN(S(=O)(=O)c4ccc5cc(Cl)ccc5c4)CC3)ccc2C1 |
| InChI | InChI=1S/C26H29ClN3O3S/c1-30(2)14-9-21-15-22(3-4-23(21)18-30)26(31)28-10-12-29(13-11-28)34(32,33)25-8-6-19-16-24(27)7-5-20(19)17-25/h3-8,15-17H,9-14,18H2,1-2H3/q+1 |
| InChIKey | JENKOEGIGQAHGC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|