About N-butyl-N'-(3-methoxypropyl)oxamide
N-butyl-N'-(3-methoxypropyl)oxamide (PubChem CID 2271137) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-butyl-N'-(3-methoxypropyl)oxamide.
Molecular Properties
| Compound Name | N-butyl-N'-(3-methoxypropyl)oxamide |
| PubChem CID | 2271137 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-butyl-N'-(3-methoxypropyl)oxamide |
| SMILES | CCCCNC(=O)C(=O)NCCCOC |
| InChI | InChI=1S/C10H20N2O3/c1-3-4-6-11-9(13)10(14)12-7-5-8-15-2/h3-8H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | HGBKEGTWHKZPMS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-(3-methoxypropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-(3-methoxypropyl)oxamide?
The IUPAC name of N-butyl-N'-(3-methoxypropyl)oxamide (CID 2271137) is N-butyl-N'-(3-methoxypropyl)oxamide.
What is the SMILES notation for N-butyl-N'-(3-methoxypropyl)oxamide?
The canonical SMILES for N-butyl-N'-(3-methoxypropyl)oxamide is CCCCNC(=O)C(=O)NCCCOC.
What is the InChIKey of N-butyl-N'-(3-methoxypropyl)oxamide?
The InChIKey is HGBKEGTWHKZPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-3-4-6-11-9(13)10(14)12-7-5-8-15-2/h3-8H2,1-2H3,(H,11,13)(H,12,14).
What are the key properties of N-butyl-N'-(3-methoxypropyl)oxamide?
N-butyl-N'-(3-methoxypropyl)oxamide has a molecular weight of 216.28 g/mol, XLogP of 0.06, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-(3-methoxypropyl)oxamide is sourced from PubChem (CID 2271137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).