About 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline
4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline (PubChem CID 22711733) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline |
| PubChem CID | 22711733 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C14H17N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h4,6-11H,3,5H2,1-2H3/b16-15+ |
| InChIKey | MMOCIPWTBPBCTO-FOCLMDBBSA-N |
| XLogP | 4.07 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline?
The IUPAC name of 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline (CID 22711733) is 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline?
The canonical SMILES for 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline is CN(C)c1ccc(/N=N/C2=CCCC=C2)cc1.
What is the InChIKey of 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline?
The InChIKey is MMOCIPWTBPBCTO-FOCLMDBBSA-N. The full InChI is InChI=1S/C14H17N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h4,6-11H,3,5H2,1-2H3/b16-15+.
What are the key properties of 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline?
4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline has a molecular weight of 227.31 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexa-1,5-dien-1-yldiazenyl)-N,N-dimethylaniline is sourced from PubChem (CID 22711733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).