C16H25N3O — CID 22711838
7-(3,5-dimethylpiperazin-1-yl)-6-methoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 22711838) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperazin-1-yl)-6-methoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(3,5-dimethylpiperazin-1-yl)-6-methoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 22711838 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 7-(3,5-dimethylpiperazin-1-yl)-6-methoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc2c(cc1N1CC(C)NC(C)C1)NCCC2 |
| InChI | InChI=1S/C16H25N3O/c1-11-9-19(10-12(2)18-11)15-8-14-13(5-4-6-17-14)7-16(15)20-3/h7-8,11-12,17-18H,4-6,9-10H2,1-3H3 |
| InChIKey | KRJHGCKLVJXGAW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|