C22H24Cl2N4O2 — CID 22711987
8-(2,4-dichlorophenyl)-N-heptan-4-yl-2-methyl-5-nitro-1,7-naphthyridin-4-amine (PubChem CID 22711987) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-N-heptan-4-yl-2-methyl-5-nitro-1,7-naphthyridin-4-amine.
| Compound Name | 8-(2,4-dichlorophenyl)-N-heptan-4-yl-2-methyl-5-nitro-1,7-naphthyridin-4-amine |
|---|---|
| PubChem CID | 22711987 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-N-heptan-4-yl-2-methyl-5-nitro-1,7-naphthyridin-4-amine |
| SMILES | CCCC(CCC)Nc1cc(C)nc2c(-c3ccc(Cl)cc3Cl)ncc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-4-6-15(7-5-2)27-18-10-13(3)26-22-20(18)19(28(29)30)12-25-21(22)16-9-8-14(23)11-17(16)24/h8-12,15H,4-7H2,1-3H3,(H,26,27) |
| InChIKey | GHKLYZZLFHDXGO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|