About 1-hydrazinyl-N,N-dimethylethanamine
1-hydrazinyl-N,N-dimethylethanamine (PubChem CID 22712017) has the molecular formula C4H13N3
and a molecular weight of 103.17 g/mol. Its IUPAC name is 1-hydrazinyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-hydrazinyl-N,N-dimethylethanamine |
| PubChem CID | 22712017 |
| Molecular Formula | C4H13N3 |
| Molecular Weight | 103.17 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | 1-hydrazinyl-N,N-dimethylethanamine |
| SMILES | CC(NN)N(C)C |
| InChI | InChI=1S/C4H13N3/c1-4(6-5)7(2)3/h4,6H,5H2,1-3H3 |
| InChIKey | RAKFANHMZBGLTP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinyl-N,N-dimethylethanamine?
The IUPAC name of 1-hydrazinyl-N,N-dimethylethanamine (CID 22712017) is 1-hydrazinyl-N,N-dimethylethanamine.
What is the SMILES notation for 1-hydrazinyl-N,N-dimethylethanamine?
The canonical SMILES for 1-hydrazinyl-N,N-dimethylethanamine is CC(NN)N(C)C.
What is the InChIKey of 1-hydrazinyl-N,N-dimethylethanamine?
The InChIKey is RAKFANHMZBGLTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N3/c1-4(6-5)7(2)3/h4,6H,5H2,1-3H3.
What are the key properties of 1-hydrazinyl-N,N-dimethylethanamine?
1-hydrazinyl-N,N-dimethylethanamine has a molecular weight of 103.17 g/mol, XLogP of -0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinyl-N,N-dimethylethanamine is sourced from PubChem (CID 22712017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).