C15H6N6O6 — CID 22712674
1-[4,6-bis(2,5-dioxopyrrol-1-yl)-1,3,5-triazin-2-yl]pyrrole-2,5-dione (PubChem CID 22712674) has the molecular formula C15H6N6O6 and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-[4,6-bis(2,5-dioxopyrrol-1-yl)-1,3,5-triazin-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[4,6-bis(2,5-dioxopyrrol-1-yl)-1,3,5-triazin-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22712674 |
| Molecular Formula | C15H6N6O6 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 1-[4,6-bis(2,5-dioxopyrrol-1-yl)-1,3,5-triazin-2-yl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1nc(N2C(=O)C=CC2=O)nc(N2C(=O)C=CC2=O)n1 |
| InChI | InChI=1S/C15H6N6O6/c22-7-1-2-8(23)19(7)13-16-14(20-9(24)3-4-10(20)25)18-15(17-13)21-11(26)5-6-12(21)27/h1-6H |
| InChIKey | QIOXVYNXRSQWNL-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 150.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|