C10H14F6O — CID 22712879
2,3,3,4,4,5-hexafluoro-2,5-dipropyloxolane (PubChem CID 22712879) has the molecular formula C10H14F6O and a molecular weight of 264.21 g/mol. Its IUPAC name is 2,3,3,4,4,5-hexafluoro-2,5-dipropyloxolane.
| Compound Name | 2,3,3,4,4,5-hexafluoro-2,5-dipropyloxolane |
|---|---|
| PubChem CID | 22712879 |
| Molecular Formula | C10H14F6O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,3,3,4,4,5-hexafluoro-2,5-dipropyloxolane |
| SMILES | CCCC1(F)OC(F)(CCC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H14F6O/c1-3-5-7(11)9(13,14)10(15,16)8(12,17-7)6-4-2/h3-6H2,1-2H3 |
| InChIKey | NSMIDDCXCSAZFK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|