About phthalazine;hydrochloride
phthalazine;hydrochloride (PubChem CID 22712976) has the molecular formula C8H7ClN2
and a molecular weight of 166.61 g/mol. Its IUPAC name is phthalazine;hydrochloride.
Molecular Properties
| Compound Name | phthalazine;hydrochloride |
| PubChem CID | 22712976 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | phthalazine;hydrochloride |
| SMILES | Cl.c1ccc2cnncc2c1 |
| InChI | InChI=1S/C8H6N2.ClH/c1-2-4-8-6-10-9-5-7(8)3-1;/h1-6H;1H |
| InChIKey | VVZNYMSMDNYBQQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phthalazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine;hydrochloride?
The IUPAC name of phthalazine;hydrochloride (CID 22712976) is phthalazine;hydrochloride.
What is the SMILES notation for phthalazine;hydrochloride?
The canonical SMILES for phthalazine;hydrochloride is Cl.c1ccc2cnncc2c1.
What is the InChIKey of phthalazine;hydrochloride?
The InChIKey is VVZNYMSMDNYBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.ClH/c1-2-4-8-6-10-9-5-7(8)3-1;/h1-6H;1H.
What are the key properties of phthalazine;hydrochloride?
phthalazine;hydrochloride has a molecular weight of 166.61 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine;hydrochloride is sourced from PubChem (CID 22712976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).