About neodymium(3+);carbonate;octahydrate
neodymium(3+);carbonate;octahydrate (PubChem CID 22713095) has the molecular formula CH16NdO11+
and a molecular weight of 348.37 g/mol. Its IUPAC name is neodymium(3+);carbonate;octahydrate.
Molecular Properties
| Compound Name | neodymium(3+);carbonate;octahydrate |
| PubChem CID | 22713095 |
| Molecular Formula | CH16NdO11+ |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | neodymium(3+);carbonate;octahydrate |
| SMILES | O.O.O.O.O.O.O.O.O=C([O-])[O-].[Nd+3] |
| InChI | InChI=1S/CH2O3.Nd.8H2O/c2-1(3)4;;;;;;;;;/h(H2,2,3,4);;8*1H2/q;+3;;;;;;;;/p-2 |
| InChIKey | LNCYCAGGYKYKBB-UHFFFAOYSA-L |
| XLogP | -9.04 |
| TPSA | 315.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | -9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze neodymium(3+);carbonate;octahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium(3+);carbonate;octahydrate?
The IUPAC name of neodymium(3+);carbonate;octahydrate (CID 22713095) is neodymium(3+);carbonate;octahydrate.
What is the SMILES notation for neodymium(3+);carbonate;octahydrate?
The canonical SMILES for neodymium(3+);carbonate;octahydrate is O.O.O.O.O.O.O.O.O=C([O-])[O-].[Nd+3].
What is the InChIKey of neodymium(3+);carbonate;octahydrate?
The InChIKey is LNCYCAGGYKYKBB-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Nd.8H2O/c2-1(3)4;;;;;;;;;/h(H2,2,3,4);;8*1H2/q;+3;;;;;;;;/p-2.
What are the key properties of neodymium(3+);carbonate;octahydrate?
neodymium(3+);carbonate;octahydrate has a molecular weight of 348.37 g/mol, XLogP of -9.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium(3+);carbonate;octahydrate is sourced from PubChem (CID 22713095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).