About methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate
methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate (PubChem CID 22713116) has the molecular formula C10H8F2N4O2S
and a molecular weight of 286.26 g/mol. Its IUPAC name is methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate.
Molecular Properties
| Compound Name | methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate |
| PubChem CID | 22713116 |
| Molecular Formula | C10H8F2N4O2S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate |
| SMILES | COC(=O)NNC(=S)Nc1cc(F)c(C#N)cc1F |
| InChI | InChI=1S/C10H8F2N4O2S/c1-18-10(17)16-15-9(19)14-8-3-6(11)5(4-13)2-7(8)12/h2-3H,1H3,(H,16,17)(H2,14,15,19) |
| InChIKey | XLQVMMDMIQGAKK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate?
The IUPAC name of methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate (CID 22713116) is methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate.
What is the SMILES notation for methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate?
The canonical SMILES for methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate is COC(=O)NNC(=S)Nc1cc(F)c(C#N)cc1F.
What is the InChIKey of methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate?
The InChIKey is XLQVMMDMIQGAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O2S/c1-18-10(17)16-15-9(19)14-8-3-6(11)5(4-13)2-7(8)12/h2-3H,1H3,(H,16,17)(H2,14,15,19).
What are the key properties of methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate?
methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate has a molecular weight of 286.26 g/mol, XLogP of 1.39, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(4-cyano-2,5-difluorophenyl)carbamothioylamino]carbamate is sourced from PubChem (CID 22713116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).