C17H16N6O4 — CID 22713492
ethyl 9-carbamoyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate (PubChem CID 22713492) has the molecular formula C17H16N6O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is ethyl 9-carbamoyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate.
| Compound Name | ethyl 9-carbamoyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 22713492 |
| Molecular Formula | C17H16N6O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 9-carbamoyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cn1c(C(N)=O)nnc1-c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C17H16N6O4/c1-3-27-17(25)13-12-7-22-15(20-21-16(22)14(18)24)10-6-9(26-2)4-5-11(10)23(12)8-19-13/h4-6,8H,3,7H2,1-2H3,(H2,18,24) |
| InChIKey | WBSNTIOUYOFGBI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |