C23H21N5O3 — CID 22713509
ethyl 9-benzyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate (PubChem CID 22713509) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is ethyl 9-benzyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate.
| Compound Name | ethyl 9-benzyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 22713509 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 9-benzyl-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cn1c(Cc3ccccc3)nnc1-c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C23H21N5O3/c1-3-31-23(29)21-19-13-27-20(11-15-7-5-4-6-8-15)25-26-22(27)17-12-16(30-2)9-10-18(17)28(19)14-24-21/h4-10,12,14H,3,11,13H2,1-2H3 |
| InChIKey | WOCOOEUMYFHJLA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |