About ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate
ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate (PubChem CID 22713929) has the molecular formula C20H21ClN2O4
and a molecular weight of 388.85 g/mol. Its IUPAC name is ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate |
| PubChem CID | 22713929 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(n2c(=O)c3c(C)onc3c3c(Cl)cccc32)CC1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-3-26-20(25)12-7-9-13(10-8-12)23-15-6-4-5-14(21)17(15)18-16(19(23)24)11(2)27-22-18/h4-6,12-13H,3,7-10H2,1-2H3 |
| InChIKey | SVWMNHUMMIVBGT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate (CID 22713929) is ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate is CCOC(=O)C1CCC(n2c(=O)c3c(C)onc3c3c(Cl)cccc32)CC1.
What is the InChIKey of ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate?
The InChIKey is SVWMNHUMMIVBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2O4/c1-3-26-20(25)12-7-9-13(10-8-12)23-15-6-4-5-14(21)17(15)18-16(19(23)24)11(2)27-22-18/h4-6,12-13H,3,7-10H2,1-2H3.
What are the key properties of ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate?
ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate has a molecular weight of 388.85 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(9-chloro-3-methyl-4-oxo-[1,2]oxazolo[4,3-c]quinolin-5-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 22713929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).